C17H12O2 — CID 98626260
(2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-1-carboxylic acid (PubChem CID 98626260) has the molecular formula C17H12O2 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-1-carboxylic acid.
| Compound Name | (2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-1-carboxylic acid |
|---|---|
| PubChem CID | 98626260 |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-1-carboxylic acid |
| SMILES | O=C(O)C12C3c4ccccc4[C@H]1[C@@H]2c1ccccc13 |
| InChI | InChI=1S/C17H12O2/c18-16(19)17-13-9-5-1-3-7-11(9)14(17)15(17)12-8-4-2-6-10(12)13/h1-8,13-15H,(H,18,19)/t13?,14-,15-,17?/m0/s1 |
| InChIKey | UMJDXPHIAPUWGB-GWUWNPHMSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |