About 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone
4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone (PubChem CID 98627) has the molecular formula C16H19NO5
and a molecular weight of 305.32 g/mol. Its IUPAC name is diethyl 5-oxo-3-phenylpyrrolidine-2,2-dicarboxylate.
Molecular Properties
| Compound Name | 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone |
| PubChem CID | 98627 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | diethyl 5-oxo-3-phenylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(CC(=O)N1)C2=CC=CC=C2)C(=O)OCC |
| InChI | InChI=1S/C16H19NO5/c1-3-21-14(19)16(15(20)22-4-2)12(10-13(18)17-16)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3,(H,17,18) |
| InChIKey | RQXLSXSKRKTNTK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | 424 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone?
The IUPAC name of 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone (CID 98627) is diethyl 5-oxo-3-phenylpyrrolidine-2,2-dicarboxylate.
What is the SMILES notation for 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone?
The canonical SMILES for 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone is CCOC(=O)C1(C(CC(=O)N1)C2=CC=CC=C2)C(=O)OCC.
What is the InChIKey of 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone?
The InChIKey is RQXLSXSKRKTNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO5/c1-3-21-14(19)16(15(20)22-4-2)12(10-13(18)17-16)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3,(H,17,18).
What are the key properties of 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone?
4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone has a molecular weight of 305.32 g/mol, XLogP of 1.60, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Phenyl-5,5-dicarbethoxy-2-pyrrolidinone is sourced from PubChem (CID 98627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).