methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate

C16H13Cl2NO4 — CID 986307

IUPACmethyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)COc2cc(Cl)ccc2Cl)c1
InChIInChI=1S/C16H13Cl2NO4/c1-22-16(21)10-3-2-4-12(7-10)19-15(20)9-23-14-8-11(17)5-6-13(14)18/h2-8H,9H2,1H3,(H,19,20)
InChIKeyXBKPCOBXSBXESK-UHFFFAOYSA-N
MW354.19 g/mol
LogP3.80
Rot. Bonds5

About methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate

methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate (PubChem CID 986307) has the molecular formula C16H13Cl2NO4 and a molecular weight of 354.19 g/mol. Its IUPAC name is methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate
PubChem CID986307
Molecular FormulaC16H13Cl2NO4
Molecular Weight354.19 g/mol
Exact Mass353.02
IUPAC Namemethyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)COc2cc(Cl)ccc2Cl)c1
InChIInChI=1S/C16H13Cl2NO4/c1-22-16(21)10-3-2-4-12(7-10)19-15(20)9-23-14-8-11(17)5-6-13(14)18/h2-8H,9H2,1H3,(H,19,20)
InChIKeyXBKPCOBXSBXESK-UHFFFAOYSA-N
XLogP3.80
TPSA64.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.19
LogP ≤ 53.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate?
The IUPAC name of methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate (CID 986307) is methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate.
What is the SMILES notation for methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate?
The canonical SMILES for methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate is COC(=O)c1cccc(NC(=O)COc2cc(Cl)ccc2Cl)c1.
What is the InChIKey of methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate?
The InChIKey is XBKPCOBXSBXESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2NO4/c1-22-16(21)10-3-2-4-12(7-10)19-15(20)9-23-14-8-11(17)5-6-13(14)18/h2-8H,9H2,1H3,(H,19,20).
What are the key properties of methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate?
methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate has a molecular weight of 354.19 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate is sourced from PubChem (CID 986307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).