C29H39N3O4 — CID 98631909
(2R)-1-[[(2R)-butan-2-yl]-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 98631909) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is (2R)-1-[[(2R)-butan-2-yl]-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[[(2R)-butan-2-yl]-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 98631909 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | (2R)-1-[[(2R)-butan-2-yl]-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN(Cc1c(CC)nn(-c2ccccc2)c1Oc1ccc(OC)cc1)[C@H](C)CC |
| InChI | InChI=1S/C29H39N3O4/c1-6-18-35-21-24(33)19-31(22(4)7-2)20-27-28(8-3)30-32(23-12-10-9-11-13-23)29(27)36-26-16-14-25(34-5)15-17-26/h6,9-17,22,24,33H,1,7-8,18-21H2,2-5H3/t22-,24-/m1/s1 |
| InChIKey | ZIZZEPHWHZTYEQ-ISKFKSNPSA-N |
| XLogP | 5.40 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|