C24H31BrN2O3S — CID 98634157
2-[(5S,7S)-3-bromo-1-adamantyl]-1-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]ethanone (PubChem CID 98634157) has the molecular formula C24H31BrN2O3S and a molecular weight of 507.49 g/mol. Its IUPAC name is 2-[(5S,7S)-3-bromo-1-adamantyl]-1-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]ethanone.
| Compound Name | 2-[(5S,7S)-3-bromo-1-adamantyl]-1-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]ethanone |
|---|---|
| PubChem CID | 98634157 |
| Molecular Formula | C24H31BrN2O3S |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 2-[(5S,7S)-3-bromo-1-adamantyl]-1-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]ethanone |
| SMILES | COc1ccc(/N=C2\SCCCN2C(=O)CC23C[C@@H]4C[C@H](CC(Br)(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C24H31BrN2O3S/c1-29-19-5-4-18(9-20(19)30-2)26-22-27(6-3-7-31-22)21(28)14-23-10-16-8-17(11-23)13-24(25,12-16)15-23/h4-5,9,16-17H,3,6-8,10-15H2,1-2H3/b26-22-/t16-,17-,23?,24?/m0/s1 |
| InChIKey | OEFRGDJUGIOVMT-DKDCHMIPSA-N |
| XLogP | 5.78 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|