C27H22N2O4S — CID 98638919
dimethyl (1S,11S,12S,13R)-1,11-diphenyl-14-thia-2,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,9-tetraene-12,13-dicarboxylate (PubChem CID 98638919) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is dimethyl (1S,11S,12S,13R)-1,11-diphenyl-14-thia-2,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,9-tetraene-12,13-dicarboxylate.
| Compound Name | dimethyl (1S,11S,12S,13R)-1,11-diphenyl-14-thia-2,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,9-tetraene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 98638919 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | dimethyl (1S,11S,12S,13R)-1,11-diphenyl-14-thia-2,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,9-tetraene-12,13-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@]2(c3ccccc3)S[C@@]1(c1ccccc1)c1nc3ccccc3n12 |
| InChI | InChI=1S/C27H22N2O4S/c1-32-23(30)21-22(24(31)33-2)27(18-13-7-4-8-14-18)29-20-16-10-9-15-19(20)28-25(29)26(21,34-27)17-11-5-3-6-12-17/h3-16,21-22H,1-2H3/t21-,22+,26+,27+/m0/s1 |
| InChIKey | RFMZGXPWULSGJC-BVZBTYANSA-N |
| XLogP | 4.32 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |