C26H31N3O4S — CID 98640172
methyl (5R)-3-[2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-oxoethyl]-7-ethyl-5-(3-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98640172) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is methyl (5R)-3-[2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-oxoethyl]-7-ethyl-5-(3-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (5R)-3-[2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-oxoethyl]-7-ethyl-5-(3-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98640172 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | methyl (5R)-3-[2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-oxoethyl]-7-ethyl-5-(3-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@@H](c2cccc(OC)c2)N2C(CC(=O)N[C@H]3C[C@H]4CC[C@H]3C4)=CSC2=N1 |
| InChI | InChI=1S/C26H31N3O4S/c1-4-20-23(25(31)33-3)24(17-6-5-7-19(12-17)32-2)29-18(14-34-26(29)28-20)13-22(30)27-21-11-15-8-9-16(21)10-15/h5-7,12,14-16,21,24H,4,8-11,13H2,1-3H3,(H,27,30)/t15-,16-,21-,24+/m0/s1 |
| InChIKey | CCSSYJCRPASYCZ-RNFQGHHASA-N |
| XLogP | 4.53 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |