C15H20O6 — CID 98642788
[(E,1R,4S,5S)-4,5-dihydroxy-1-[(2R)-5-oxo-2H-furan-2-yl]hex-2-enyl] (E)-2-methylbut-2-enoate (PubChem CID 98642788) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is [(E,1R,4S,5S)-4,5-dihydroxy-1-[(2R)-5-oxo-2H-furan-2-yl]hex-2-enyl] (E)-2-methylbut-2-enoate.
| Compound Name | [(E,1R,4S,5S)-4,5-dihydroxy-1-[(2R)-5-oxo-2H-furan-2-yl]hex-2-enyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 98642788 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [(E,1R,4S,5S)-4,5-dihydroxy-1-[(2R)-5-oxo-2H-furan-2-yl]hex-2-enyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H](/C=C/[C@H](O)[C@H](C)O)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C15H20O6/c1-4-9(2)15(19)21-13(6-5-11(17)10(3)16)12-7-8-14(18)20-12/h4-8,10-13,16-17H,1-3H3/b6-5+,9-4+/t10-,11-,12+,13+/m0/s1 |
| InChIKey | ZABCZCJKVSSDHF-XMDMPDKVSA-N |
| XLogP | 0.64 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|