C21H28O8 — CID 98643386
[(3aS,4S,5E,9Z,11aS)-6-(acetyloxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2S)-2,3-dihydroxy-2-methylpropanoate (PubChem CID 98643386) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(3aS,4S,5E,9Z,11aS)-6-(acetyloxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2S)-2,3-dihydroxy-2-methylpropanoate.
| Compound Name | [(3aS,4S,5E,9Z,11aS)-6-(acetyloxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2S)-2,3-dihydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 98643386 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(3aS,4S,5E,9Z,11aS)-6-(acetyloxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2S)-2,3-dihydroxy-2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@H]2C/C(C)=C\CC/C(COC(C)=O)=C\[C@H](OC(=O)[C@@](C)(O)CO)[C@@H]12 |
| InChI | InChI=1S/C21H28O8/c1-12-6-5-7-15(10-27-14(3)23)9-17(29-20(25)21(4,26)11-22)18-13(2)19(24)28-16(18)8-12/h6,9,16-18,22,26H,2,5,7-8,10-11H2,1,3-4H3/b12-6-,15-9+/t16-,17-,18-,21-/m0/s1 |
| InChIKey | SQQDHMIYFXZFNM-IDIUDKTOSA-N |
| XLogP | 1.36 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|