C15H16N2O2S — CID 98650629
N-[(E)-[(1S,2R,6S,7S)-3,3-dioxo-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ylidene]amino]aniline (PubChem CID 98650629) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-[(E)-[(1S,2R,6S,7S)-3,3-dioxo-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ylidene]amino]aniline.
| Compound Name | N-[(E)-[(1S,2R,6S,7S)-3,3-dioxo-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ylidene]amino]aniline |
|---|---|
| PubChem CID | 98650629 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[(E)-[(1S,2R,6S,7S)-3,3-dioxo-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ylidene]amino]aniline |
| SMILES | O=S1(=O)C/C(=N/Nc2ccccc2)[C@H]2[C@H]1[C@@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H16N2O2S/c18-20(19)9-13(17-16-12-4-2-1-3-5-12)14-10-6-7-11(8-10)15(14)20/h1-7,10-11,14-16H,8-9H2/b17-13-/t10-,11-,14+,15-/m1/s1 |
| InChIKey | HPCDIHLTINGUQN-UDDWUEADSA-N |
| XLogP | 2.07 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|