C22H24N4O2 — CID 98657038
(1R,6R,8S,12R)-9-imino-12-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile (PubChem CID 98657038) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1R,6R,8S,12R)-9-imino-12-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile.
| Compound Name | (1R,6R,8S,12R)-9-imino-12-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
|---|---|
| PubChem CID | 98657038 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1R,6R,8S,12R)-9-imino-12-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@]23CCCC[C@@H]2C(C#N)(C#N)[C@]1(C#N)[C@@H](C1=CC[C@@H](C(=C)C)CC1)O3 |
| InChI | InChI=1S/C22H24N4O2/c1-14(2)15-6-8-16(9-7-15)18-21(13-25)19(26)28-22(27-18)10-4-3-5-17(22)20(21,11-23)12-24/h8,15,17-18,26H,1,3-7,9-10H2,2H3/b26-19-/t15-,17-,18-,21-,22-/m1/s1 |
| InChIKey | LOISBJJFWMKRLS-ZAVKDYDGSA-N |
| XLogP | 4.13 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|