C26H31N3O4 — CID 98664822
(3R)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-6-(furan-2-yl)-2-(furan-2-ylmethyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 98664822) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (3R)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-6-(furan-2-yl)-2-(furan-2-ylmethyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | (3R)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-6-(furan-2-yl)-2-(furan-2-ylmethyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 98664822 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (3R)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-6-(furan-2-yl)-2-(furan-2-ylmethyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@]1(C)Cn2c(ccc2-c2ccco2)C(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C26H31N3O4/c1-17-7-4-9-20(18(17)2)27-25(31)26(3)16-28-21(23-10-6-14-33-23)11-12-22(28)24(30)29(26)15-19-8-5-13-32-19/h5-6,8,10-14,17-18,20H,4,7,9,15-16H2,1-3H3,(H,27,31)/t17-,18+,20+,26-/m1/s1 |
| InChIKey | QZRZCEZOOJEPLG-BVFWVQIHSA-N |
| XLogP | 4.70 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |