C22H33N5O4S2 — CID 98671369
(2R)-2-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide (PubChem CID 98671369) has the molecular formula C22H33N5O4S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is (2R)-2-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide.
| Compound Name | (2R)-2-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 98671369 |
| Molecular Formula | C22H33N5O4S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (2R)-2-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
| SMILES | C[C@@H]1C[C@H](C)CN(c2nnc(S[C@H](C)C(=O)N(C)[C@@H]3CCS(=O)(=O)C3)n2Cc2ccco2)C1 |
| InChI | InChI=1S/C22H33N5O4S2/c1-15-10-16(2)12-26(11-15)21-23-24-22(27(21)13-19-6-5-8-31-19)32-17(3)20(28)25(4)18-7-9-33(29,30)14-18/h5-6,8,15-18H,7,9-14H2,1-4H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | ZPVQTYSSCUXGIV-XMTFNYHQSA-N |
| XLogP | 2.53 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |