C19H27BrF3NO — CID 98671655
2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 98671655) has the molecular formula C19H27BrF3NO and a molecular weight of 422.33 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 98671655 |
| Molecular Formula | C19H27BrF3NO |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)N[C@@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C19H27BrF3NO/c20-18-8-12-4-13(9-18)7-17(6-12,11-18)10-16(25)24-15-3-1-2-14(5-15)19(21,22)23/h12-15H,1-11H2,(H,24,25)/t12-,13-,14+,15-,17?,18?/m1/s1 |
| InChIKey | TYSBSPPWMGVOLY-JGKCQHDJSA-N |
| XLogP | 5.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|