C20H29N5OS — CID 98679201
(2R)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 98679201) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 98679201 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (2R)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | Cc1nc2nc(S[C@H](C)C(=O)N[C@H](C)[C@@H]3C[C@H]4CC[C@H]3C4)nn2c(C)c1C |
| InChI | InChI=1S/C20H29N5OS/c1-10-11(2)22-19-23-20(24-25(19)13(10)4)27-14(5)18(26)21-12(3)17-9-15-6-7-16(17)8-15/h12,14-17H,6-9H2,1-5H3,(H,21,26)/t12-,14-,15+,16+,17+/m1/s1 |
| InChIKey | OYPWSCOIGFYXBB-ZUOZUFPHSA-N |
| XLogP | 3.47 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |