About 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one
8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 98684753) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one.
Molecular Properties
| Compound Name | 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
| PubChem CID | 98684753 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | CCc1cc(=O)n2c(c1N)NCC2 |
| InChI | InChI=1S/C9H13N3O/c1-2-6-5-7(13)12-4-3-11-9(12)8(6)10/h5,11H,2-4,10H2,1H3 |
| InChIKey | AYWAJFDBDWXONT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one?
The IUPAC name of 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one (CID 98684753) is 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one.
What is the SMILES notation for 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one?
The canonical SMILES for 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one is CCc1cc(=O)n2c(c1N)NCC2.
What is the InChIKey of 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one?
The InChIKey is AYWAJFDBDWXONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-2-6-5-7(13)12-4-3-11-9(12)8(6)10/h5,11H,2-4,10H2,1H3.
What are the key properties of 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one?
8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one has a molecular weight of 179.22 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-7-ethyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one is sourced from PubChem (CID 98684753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).