About 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide
4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide (PubChem CID 98691639) has the molecular formula C23H29BrN2O3
and a molecular weight of 461.40 g/mol. Its IUPAC name is 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide.
Molecular Properties
| Compound Name | 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide |
| PubChem CID | 98691639 |
| Molecular Formula | C23H29BrN2O3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide |
| SMILES | CCN(C(=O)c1cc(OC)c(Br)c(OC)c1)[C@H]1CCN([C@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C23H29BrN2O3/c1-5-26(23(27)18-13-20(28-3)22(24)21(14-18)29-4)19-11-12-25(15-19)16(2)17-9-7-6-8-10-17/h6-10,13-14,16,19H,5,11-12,15H2,1-4H3/t16-,19+/m1/s1 |
| InChIKey | VMRBFEVPGQPSCR-APWZRJJASA-N |
| XLogP | 4.76 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide?
The IUPAC name of 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide (CID 98691639) is 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide.
What is the SMILES notation for 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide?
The canonical SMILES for 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide is CCN(C(=O)c1cc(OC)c(Br)c(OC)c1)[C@H]1CCN([C@H](C)c2ccccc2)C1.
What is the InChIKey of 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide?
The InChIKey is VMRBFEVPGQPSCR-APWZRJJASA-N. The full InChI is InChI=1S/C23H29BrN2O3/c1-5-26(23(27)18-13-20(28-3)22(24)21(14-18)29-4)19-11-12-25(15-19)16(2)17-9-7-6-8-10-17/h6-10,13-14,16,19H,5,11-12,15H2,1-4H3/t16-,19+/m1/s1.
What are the key properties of 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide?
4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide has a molecular weight of 461.40 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-ethyl-3,5-dimethoxy-N-[(3S)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]benzamide is sourced from PubChem (CID 98691639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).