C17H20N2OS — CID 98700577
3-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 98700577) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 98700577 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | C[C@H]([C@@H]1C[C@H]2CC[C@H]1C2)n1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C17H20N2OS/c1-10(14-9-11-6-7-12(14)8-11)19-16(20)13-4-2-3-5-15(13)18-17(19)21/h2-5,10-12,14H,6-9H2,1H3,(H,18,21)/t10-,11+,12+,14+/m1/s1 |
| InChIKey | SBNKCZCJWMFYKY-UHXUPSOCSA-N |
| XLogP | 4.06 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|