C27H32N2O5 — CID 98703956
(3S,3aR,6aR)-3-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98703956) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-3-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98703956 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (3S,3aR,6aR)-3-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc(CCN2C(=O)[C@H]3[C@@H](ON(c4ccccc4)[C@H]3C3CCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C27H32N2O5/c1-32-21-14-13-18(17-22(21)33-2)15-16-28-26(30)23-24(19-9-5-3-6-10-19)29(34-25(23)27(28)31)20-11-7-4-8-12-20/h4,7-8,11-14,17,19,23-25H,3,5-6,9-10,15-16H2,1-2H3/t23-,24+,25-/m1/s1 |
| InChIKey | RCMACQQNRTZIDC-DSNGMDLFSA-N |
| XLogP | 4.00 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|