C33H22Cl2N2O4 — CID 98713833
(2S,6R,7S,11S)-15-chloro-6-[(4-chlorophenyl)methyl]-4,9-diphenyl-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone (PubChem CID 98713833) has the molecular formula C33H22Cl2N2O4 and a molecular weight of 581.46 g/mol. Its IUPAC name is (2S,6R,7S,11S)-15-chloro-6-[(4-chlorophenyl)methyl]-4,9-diphenyl-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone.
| Compound Name | (2S,6R,7S,11S)-15-chloro-6-[(4-chlorophenyl)methyl]-4,9-diphenyl-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 98713833 |
| Molecular Formula | C33H22Cl2N2O4 |
| Molecular Weight | 581.46 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | (2S,6R,7S,11S)-15-chloro-6-[(4-chlorophenyl)methyl]-4,9-diphenyl-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone |
| SMILES | O=C1[C@@H]2c3ccc(Cl)cc3[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@]3(Cc3ccc(Cl)cc3)[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C33H22Cl2N2O4/c34-20-13-11-19(12-14-20)18-33-27(30(39)37(32(33)41)23-9-5-2-6-10-23)25-17-21(35)15-16-24(25)26-28(33)31(40)36(29(26)38)22-7-3-1-4-8-22/h1-17,26-28H,18H2/t26-,27-,28-,33+/m1/s1 |
| InChIKey | REUQLSNLGLFQKT-NPJKBUODSA-N |
| XLogP | 6.17 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|