About CID 98715346
CID 98715346 (PubChem CID 98715346) has the molecular formula C25H21ClN4O3S2
and a molecular weight of 525.06 g/mol.
Molecular Properties
| Compound Name | CID 98715346 |
| PubChem CID | 98715346 |
| Molecular Formula | C25H21ClN4O3S2 |
| Molecular Weight | 525.06 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@]2(c3cc(Cl)ccc31)N(C)C[C@H](c1ccccn1)[C@]21SC(=S)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C25H21ClN4O3S2/c1-28-14-18(19-7-3-4-10-27-19)25(22(32)30(23(34)35-25)13-16-6-5-11-33-16)24(28)17-12-15(26)8-9-20(17)29(2)21(24)31/h3-12,18H,13-14H2,1-2H3/t18-,24+,25-/m1/s1 |
| InChIKey | FJVPZIUKYZDSRG-AYCKEJKLSA-N |
| XLogP | 4.03 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.06 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 98715346 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 98715346?
The IUPAC name of CID 98715346 (CID 98715346) is not available.
What is the SMILES notation for CID 98715346?
The canonical SMILES for CID 98715346 is CN1C(=O)[C@]2(c3cc(Cl)ccc31)N(C)C[C@H](c1ccccn1)[C@]21SC(=S)N(Cc2ccco2)C1=O.
What is the InChIKey of CID 98715346?
The InChIKey is FJVPZIUKYZDSRG-AYCKEJKLSA-N. The full InChI is InChI=1S/C25H21ClN4O3S2/c1-28-14-18(19-7-3-4-10-27-19)25(22(32)30(23(34)35-25)13-16-6-5-11-33-16)24(28)17-12-15(26)8-9-20(17)29(2)21(24)31/h3-12,18H,13-14H2,1-2H3/t18-,24+,25-/m1/s1.
What are the key properties of CID 98715346?
CID 98715346 has a molecular weight of 525.06 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 98715346 is sourced from PubChem (CID 98715346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).