C17H26N2O4 — CID 98724413
N-[(2S)-1-[2-[(1R,2S)-2-methylcyclohexyl]oxyethylamino]-1-oxopropan-2-yl]furan-3-carboxamide (PubChem CID 98724413) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is N-[(2S)-1-[2-[(1R,2S)-2-methylcyclohexyl]oxyethylamino]-1-oxopropan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2S)-1-[2-[(1R,2S)-2-methylcyclohexyl]oxyethylamino]-1-oxopropan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 98724413 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[(2S)-1-[2-[(1R,2S)-2-methylcyclohexyl]oxyethylamino]-1-oxopropan-2-yl]furan-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccoc1)C(=O)NCCO[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C17H26N2O4/c1-12-5-3-4-6-15(12)23-10-8-18-16(20)13(2)19-17(21)14-7-9-22-11-14/h7,9,11-13,15H,3-6,8,10H2,1-2H3,(H,18,20)(H,19,21)/t12-,13-,15+/m0/s1 |
| InChIKey | PVNGHKAAARFAAV-KCQAQPDRSA-N |
| XLogP | 2.11 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|