About [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine
[(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine (PubChem CID 98729472) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine.
Molecular Properties
| Compound Name | [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine |
| PubChem CID | 98729472 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine |
| SMILES | NC[C@H]1[C@@H]2CCO[C@@H]12 |
| InChI | InChI=1S/C6H11NO/c7-3-5-4-1-2-8-6(4)5/h4-6H,1-3,7H2/t4-,5-,6+/m0/s1 |
| InChIKey | AECSHWNFEPPOOE-HCWXCVPCSA-N |
| XLogP | -0.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
The IUPAC name of [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine (CID 98729472) is [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine.
What is the SMILES notation for [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
The canonical SMILES for [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine is NC[C@H]1[C@@H]2CCO[C@@H]12.
What is the InChIKey of [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
The InChIKey is AECSHWNFEPPOOE-HCWXCVPCSA-N. The full InChI is InChI=1S/C6H11NO/c7-3-5-4-1-2-8-6(4)5/h4-6H,1-3,7H2/t4-,5-,6+/m0/s1.
What are the key properties of [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
[(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine has a molecular weight of 113.16 g/mol, XLogP of -0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S,6R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine is sourced from PubChem (CID 98729472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).