C22H19FN2OS — CID 98732129
(E)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 98732129) has the molecular formula C22H19FN2OS and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98732129 |
| Molecular Formula | C22H19FN2OS |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (E)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)Nc1ccccc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C22H19FN2OS/c23-18-8-5-16(6-9-18)7-10-22(26)24-19-3-1-2-4-20(19)25-13-11-21-17(15-25)12-14-27-21/h1-10,12,14H,11,13,15H2,(H,24,26)/b10-7+ |
| InChIKey | KXEUHDXQXNZCMA-JXMROGBWSA-N |
| XLogP | 5.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|