C20H24N2OS — CID 98739809
3-[5-[[(2S)-2-methyl-4-(2-methylphenyl)piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol (PubChem CID 98739809) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 3-[5-[[(2S)-2-methyl-4-(2-methylphenyl)piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[[(2S)-2-methyl-4-(2-methylphenyl)piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 98739809 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-[5-[[(2S)-2-methyl-4-(2-methylphenyl)piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
| SMILES | Cc1ccccc1N1CCN(Cc2ccc(C#CCO)s2)[C@@H](C)C1 |
| InChI | InChI=1S/C20H24N2OS/c1-16-6-3-4-8-20(16)22-12-11-21(17(2)14-22)15-19-10-9-18(24-19)7-5-13-23/h3-4,6,8-10,17,23H,11-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | KYNVWCLWWCWLKD-KRWDZBQOSA-N |
| XLogP | 3.11 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|