C23H18N4OS — CID 987427
(9S,11S)-11-(4-methylphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 987427) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is (9S,11S)-11-(4-methylphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9S,11S)-11-(4-methylphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 987427 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (9S,11S)-11-(4-methylphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Cc1ccc([C@H]2C3=C(Nc4ncnn42)c2ccccc2O[C@@H]3c2cccs2)cc1 |
| InChI | InChI=1S/C23H18N4OS/c1-14-8-10-15(11-9-14)21-19-20(26-23-24-13-25-27(21)23)16-5-2-3-6-17(16)28-22(19)18-7-4-12-29-18/h2-13,21-22H,1H3,(H,24,25,26)/t21-,22+/m0/s1 |
| InChIKey | NAWVBLZNAIAHLQ-FCHUYYIVSA-N |
| XLogP | 5.21 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |