C20H37N3O2 — CID 98742769
N-cyclooctyl-2-[(3S)-4-(cyclopropylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]acetamide (PubChem CID 98742769) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is N-cyclooctyl-2-[(3S)-4-(cyclopropylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N-cyclooctyl-2-[(3S)-4-(cyclopropylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 98742769 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | N-cyclooctyl-2-[(3S)-4-(cyclopropylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CC2CC2)[C@@H](CCO)C1)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H37N3O2/c24-13-10-19-15-22(11-12-23(19)14-17-8-9-17)16-20(25)21-18-6-4-2-1-3-5-7-18/h17-19,24H,1-16H2,(H,21,25)/t19-/m0/s1 |
| InChIKey | VHCLOKRBQKGENE-IBGZPJMESA-N |
| XLogP | 1.99 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |