About 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole
1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole (PubChem CID 98749281) has the molecular formula C11H18F2N2S
and a molecular weight of 248.34 g/mol. Its IUPAC name is 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole.
Molecular Properties
| Compound Name | 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole |
| PubChem CID | 98749281 |
| Molecular Formula | C11H18F2N2S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole |
| SMILES | CCCCn1c(SCC(F)F)nc(C)c1C |
| InChI | InChI=1S/C11H18F2N2S/c1-4-5-6-15-9(3)8(2)14-11(15)16-7-10(12)13/h10H,4-7H2,1-3H3 |
| InChIKey | CMBUBVTUZYDBAB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole?
The IUPAC name of 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole (CID 98749281) is 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole.
What is the SMILES notation for 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole?
The canonical SMILES for 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole is CCCCn1c(SCC(F)F)nc(C)c1C.
What is the InChIKey of 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole?
The InChIKey is CMBUBVTUZYDBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N2S/c1-4-5-6-15-9(3)8(2)14-11(15)16-7-10(12)13/h10H,4-7H2,1-3H3.
What are the key properties of 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole?
1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole has a molecular weight of 248.34 g/mol, XLogP of 3.66, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-(2,2-difluoroethylsulfanyl)-4,5-dimethylimidazole is sourced from PubChem (CID 98749281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).