About (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine
(2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine (PubChem CID 98750419) has the molecular formula C14H20ClNO3S
and a molecular weight of 317.84 g/mol. Its IUPAC name is (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine |
| PubChem CID | 98750419 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine |
| SMILES | C[C@H]1CN(CCS(=O)(=O)c2ccc(Cl)cc2)[C@@H](C)CO1 |
| InChI | InChI=1S/C14H20ClNO3S/c1-11-10-19-12(2)9-16(11)7-8-20(17,18)14-5-3-13(15)4-6-14/h3-6,11-12H,7-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | IBVZXKSENKSYBK-RYUDHWBXSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine?
The IUPAC name of (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine (CID 98750419) is (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine.
What is the SMILES notation for (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine?
The canonical SMILES for (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine is C[C@H]1CN(CCS(=O)(=O)c2ccc(Cl)cc2)[C@@H](C)CO1.
What is the InChIKey of (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine?
The InChIKey is IBVZXKSENKSYBK-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H20ClNO3S/c1-11-10-19-12(2)9-16(11)7-8-20(17,18)14-5-3-13(15)4-6-14/h3-6,11-12H,7-10H2,1-2H3/t11-,12-/m0/s1.
What are the key properties of (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine?
(2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine has a molecular weight of 317.84 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-4-[2-(4-chlorophenyl)sulfonylethyl]-2,5-dimethylmorpholine is sourced from PubChem (CID 98750419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).