C11H19N — CID 98751418
(1R,2R,3S,4R,6R)-N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine (PubChem CID 98751418) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (1R,2R,3S,4R,6R)-N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine.
| Compound Name | (1R,2R,3S,4R,6R)-N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine |
|---|---|
| PubChem CID | 98751418 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (1R,2R,3S,4R,6R)-N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine |
| SMILES | CCN[C@H]1[C@@H]2C[C@@H]3[C@@H]1[C@]3(CC)C2 |
| InChI | InChI=1S/C11H19N/c1-3-11-6-7-5-8(11)9(11)10(7)12-4-2/h7-10,12H,3-6H2,1-2H3/t7-,8-,9+,10+,11-/m1/s1 |
| InChIKey | JXABZUKPGATLHK-SAVGLBRCSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |