C22H24N2O4S — CID 98752209
methyl (1R,9S,13S)-10-(4-ethylphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate (PubChem CID 98752209) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is methyl (1R,9S,13S)-10-(4-ethylphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate.
| Compound Name | methyl (1R,9S,13S)-10-(4-ethylphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 98752209 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl (1R,9S,13S)-10-(4-ethylphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
| SMILES | CCc1ccc(N2C(=S)N[C@H]3c4cccc(OC)c4O[C@@]2(C)[C@H]3C(=O)OC)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-5-13-9-11-14(12-10-13)24-21(29)23-18-15-7-6-8-16(26-3)19(15)28-22(24,2)17(18)20(25)27-4/h6-12,17-18H,5H2,1-4H3,(H,23,29)/t17-,18+,22+/m1/s1 |
| InChIKey | JLHBAKMHJKJQAJ-FGSXEWAUSA-N |
| XLogP | 3.59 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|