C23H28N2O3 — CID 987535
N,N-dimethyl-4-[(6R,8R)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]aniline (PubChem CID 987535) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[(6R,8R)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(6R,8R)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]aniline |
|---|---|
| PubChem CID | 987535 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N,N-dimethyl-4-[(6R,8R)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]aniline |
| SMILES | CN(C)c1ccc([C@H]2C[C@](C)(N3CCCC3)Oc3cc4c(cc32)OCO4)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-23(25-10-4-5-11-25)14-19(16-6-8-17(9-7-16)24(2)3)18-12-21-22(27-15-26-21)13-20(18)28-23/h6-9,12-13,19H,4-5,10-11,14-15H2,1-3H3/t19-,23-/m1/s1 |
| InChIKey | MMXOGJYYUBSYLU-AUSIDOKSSA-N |
| XLogP | 4.21 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|