C16H25ClN2O3S — CID 98753510
(5R,7R)-3-chloro-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]adamantane-1-carboxamide (PubChem CID 98753510) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98753510 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (5R,7R)-3-chloro-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCCN1CCCS1(=O)=O)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C16H25ClN2O3S/c17-16-9-12-6-13(10-16)8-15(7-12,11-16)14(20)18-2-4-19-3-1-5-23(19,21)22/h12-13H,1-11H2,(H,18,20)/t12-,13-,15?,16?/m1/s1 |
| InChIKey | DWWSEHWNTURWHE-KCNJBTMXSA-N |
| XLogP | 1.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|