About methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate
methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate (PubChem CID 98753988) has the molecular formula C14H18FNO5S
and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate |
| PubChem CID | 98753988 |
| Molecular Formula | C14H18FNO5S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)cc1S(=O)(=O)N1C[C@@H](C)OC[C@@H]1C |
| InChI | InChI=1S/C14H18FNO5S/c1-9-8-21-10(2)7-16(9)22(18,19)13-6-11(15)4-5-12(13)14(17)20-3/h4-6,9-10H,7-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | MAGFWRXEKJNKKI-VHSXEESVSA-N |
| XLogP | 1.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate?
The IUPAC name of methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate (CID 98753988) is methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate.
What is the SMILES notation for methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate?
The canonical SMILES for methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate is COC(=O)c1ccc(F)cc1S(=O)(=O)N1C[C@@H](C)OC[C@@H]1C.
What is the InChIKey of methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate?
The InChIKey is MAGFWRXEKJNKKI-VHSXEESVSA-N. The full InChI is InChI=1S/C14H18FNO5S/c1-9-8-21-10(2)7-16(9)22(18,19)13-6-11(15)4-5-12(13)14(17)20-3/h4-6,9-10H,7-8H2,1-3H3/t9-,10+/m0/s1.
What are the key properties of methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate?
methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate has a molecular weight of 331.37 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]sulfonyl-4-fluorobenzoate is sourced from PubChem (CID 98753988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).