C22H28N4O7 — CID 98755203
ethyl (4R)-6-[[(3S)-3-ethoxycarbonylpiperidin-1-yl]methyl]-4-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 98755203) has the molecular formula C22H28N4O7 and a molecular weight of 460.49 g/mol. Its IUPAC name is ethyl (4R)-6-[[(3S)-3-ethoxycarbonylpiperidin-1-yl]methyl]-4-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-6-[[(3S)-3-ethoxycarbonylpiperidin-1-yl]methyl]-4-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 98755203 |
| Molecular Formula | C22H28N4O7 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | ethyl (4R)-6-[[(3S)-3-ethoxycarbonylpiperidin-1-yl]methyl]-4-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CCC[C@H](C(=O)OCC)C2)NC(=O)N[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H28N4O7/c1-3-32-20(27)15-6-5-11-25(12-15)13-17-18(21(28)33-4-2)19(24-22(29)23-17)14-7-9-16(10-8-14)26(30)31/h7-10,15,19H,3-6,11-13H2,1-2H3,(H2,23,24,29)/t15-,19+/m0/s1 |
| InChIKey | KBQPSGKFNMTNMP-HNAYVOBHSA-N |
| XLogP | 2.04 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|