C15H21F3N2O3 — CID 98758883
(1S)-2-[[(2S)-4-methylmorpholin-2-yl]methylamino]-1-[4-(trifluoromethoxy)phenyl]ethanol (PubChem CID 98758883) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is (1S)-2-[[(2S)-4-methylmorpholin-2-yl]methylamino]-1-[4-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | (1S)-2-[[(2S)-4-methylmorpholin-2-yl]methylamino]-1-[4-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 98758883 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (1S)-2-[[(2S)-4-methylmorpholin-2-yl]methylamino]-1-[4-(trifluoromethoxy)phenyl]ethanol |
| SMILES | CN1CCO[C@@H](CNC[C@@H](O)c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H21F3N2O3/c1-20-6-7-22-13(10-20)8-19-9-14(21)11-2-4-12(5-3-11)23-15(16,17)18/h2-5,13-14,19,21H,6-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | COBDBPAQHWPDBO-UONOGXRCSA-N |
| XLogP | 1.54 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |