C18H35N3O2 — CID 98761337
(2R)-N-(cyclohexylmethyl)-2-[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]propanamide (PubChem CID 98761337) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is (2R)-N-(cyclohexylmethyl)-2-[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(cyclohexylmethyl)-2-[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 98761337 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | (2R)-N-(cyclohexylmethyl)-2-[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]propanamide |
| SMILES | COCCN1CCN([C@H](C)C(=O)NCC2CCCCC2)C[C@@H]1C |
| InChI | InChI=1S/C18H35N3O2/c1-15-14-21(10-9-20(15)11-12-23-3)16(2)18(22)19-13-17-7-5-4-6-8-17/h15-17H,4-14H2,1-3H3,(H,19,22)/t15-,16+/m0/s1 |
| InChIKey | DQEUGBCVAZNVFZ-JKSUJKDBSA-N |
| XLogP | 1.72 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |