C13H22N4O — CID 98761781
(2S)-2-[[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]methyl]pentanedinitrile (PubChem CID 98761781) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]methyl]pentanedinitrile.
| Compound Name | (2S)-2-[[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]methyl]pentanedinitrile |
|---|---|
| PubChem CID | 98761781 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (2S)-2-[[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]methyl]pentanedinitrile |
| SMILES | CN(C)C[C@@H]1CN(C[C@@H](C#N)CCC#N)CCO1 |
| InChI | InChI=1S/C13H22N4O/c1-16(2)10-13-11-17(6-7-18-13)9-12(8-15)4-3-5-14/h12-13H,3-4,6-7,9-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | AMWSCZBILMJSAB-CHWSQXEVSA-N |
| XLogP | 0.69 |
| TPSA | 63.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |