C19H28N4O — CID 98762961
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone (PubChem CID 98762961) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 98762961 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(c2ncccn2)C1)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H28N4O/c24-18(23-13-4-7-15-6-1-2-9-17(15)23)16-8-3-12-22(14-16)19-20-10-5-11-21-19/h5,10-11,15-17H,1-4,6-9,12-14H2/t15-,16+,17+/m0/s1 |
| InChIKey | VOLDSXKMYWHDBF-GVDBMIGSSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |