About (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one
(3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one (PubChem CID 98765643) has the molecular formula C14H21N3O2
and a molecular weight of 263.34 g/mol. Its IUPAC name is (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one.
Molecular Properties
| Compound Name | (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one |
| PubChem CID | 98765643 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one |
| SMILES | Cc1cc(C)n(C[C@H]2CCCN2[C@H]2CCOC2=O)n1 |
| InChI | InChI=1S/C14H21N3O2/c1-10-8-11(2)17(15-10)9-12-4-3-6-16(12)13-5-7-19-14(13)18/h8,12-13H,3-7,9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | NKARYDGFYXGRKW-OLZOCXBDSA-N |
| XLogP | 1.28 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one?
The IUPAC name of (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one (CID 98765643) is (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one.
What is the SMILES notation for (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one?
The canonical SMILES for (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one is Cc1cc(C)n(C[C@H]2CCCN2[C@H]2CCOC2=O)n1.
What is the InChIKey of (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one?
The InChIKey is NKARYDGFYXGRKW-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H21N3O2/c1-10-8-11(2)17(15-10)9-12-4-3-6-16(12)13-5-7-19-14(13)18/h8,12-13H,3-7,9H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one?
(3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one has a molecular weight of 263.34 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]oxolan-2-one is sourced from PubChem (CID 98765643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).