C13H25N3O — CID 98767254
4-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]butanenitrile (PubChem CID 98767254) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]butanenitrile.
| Compound Name | 4-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 98767254 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 4-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]butanenitrile |
| SMILES | CC[C@@H]1CN(CCCC#N)CCN1C[C@H](C)O |
| InChI | InChI=1S/C13H25N3O/c1-3-13-11-15(7-5-4-6-14)8-9-16(13)10-12(2)17/h12-13,17H,3-5,7-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | PPMRQOXIQLAMKQ-QWHCGFSZSA-N |
| XLogP | 1.07 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|