About 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide
2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 987683) has the molecular formula C17H11Cl3N2OS
and a molecular weight of 397.71 g/mol. Its IUPAC name is 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 987683 |
| Molecular Formula | C17H11Cl3N2OS |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(Cl)c(Cl)c2)s1)c1ccccc1Cl |
| InChI | InChI=1S/C17H11Cl3N2OS/c18-13-4-2-1-3-12(13)16(23)22-17-21-9-11(24-17)7-10-5-6-14(19)15(20)8-10/h1-6,8-9H,7H2,(H,21,22,23) |
| InChIKey | KNTQNHXXWMEMMU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide?
The IUPAC name of 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide (CID 987683) is 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide is O=C(Nc1ncc(Cc2ccc(Cl)c(Cl)c2)s1)c1ccccc1Cl.
What is the InChIKey of 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide?
The InChIKey is KNTQNHXXWMEMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl3N2OS/c18-13-4-2-1-3-12(13)16(23)22-17-21-9-11(24-17)7-10-5-6-14(19)15(20)8-10/h1-6,8-9H,7H2,(H,21,22,23).
What are the key properties of 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide?
2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide has a molecular weight of 397.71 g/mol, XLogP of 5.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 987683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).