C10H9Cl2NO2S — CID 98770479
4-chloro-2,7-dimethyl-1H-indole-3-sulfonyl chloride (PubChem CID 98770479) has the molecular formula C10H9Cl2NO2S and a molecular weight of 278.16 g/mol. Its IUPAC name is 4-chloro-2,7-dimethyl-1H-indole-3-sulfonyl chloride.
| Compound Name | 4-chloro-2,7-dimethyl-1H-indole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 98770479 |
| Molecular Formula | C10H9Cl2NO2S |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 4-chloro-2,7-dimethyl-1H-indole-3-sulfonyl chloride |
| SMILES | Cc1[nH]c2c(C)ccc(Cl)c2c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H9Cl2NO2S/c1-5-3-4-7(11)8-9(5)13-6(2)10(8)16(12,14)15/h3-4,13H,1-2H3 |
| InChIKey | VDNIBHZTTPOIHD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |