About 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol
2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol (PubChem CID 98771280) has the molecular formula C23H34N4O
and a molecular weight of 382.55 g/mol. Its IUPAC name is 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol |
| PubChem CID | 98771280 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol |
| SMILES | Cc1cc(C)c2nccc(N3CCN(C4CCN(C)CC4)[C@@H](CCO)C3)c2c1 |
| InChI | InChI=1S/C23H34N4O/c1-17-14-18(2)23-21(15-17)22(4-8-24-23)26-11-12-27(20(16-26)7-13-28)19-5-9-25(3)10-6-19/h4,8,14-15,19-20,28H,5-7,9-13,16H2,1-3H3/t20-/m0/s1 |
| InChIKey | MAHUNNGYNADBDL-FQEVSTJZSA-N |
| XLogP | 2.82 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol?
The IUPAC name of 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol (CID 98771280) is 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol.
What is the SMILES notation for 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol?
The canonical SMILES for 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol is Cc1cc(C)c2nccc(N3CCN(C4CCN(C)CC4)[C@@H](CCO)C3)c2c1.
What is the InChIKey of 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol?
The InChIKey is MAHUNNGYNADBDL-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H34N4O/c1-17-14-18(2)23-21(15-17)22(4-8-24-23)26-11-12-27(20(16-26)7-13-28)19-5-9-25(3)10-6-19/h4,8,14-15,19-20,28H,5-7,9-13,16H2,1-3H3/t20-/m0/s1.
What are the key properties of 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol?
2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol has a molecular weight of 382.55 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-4-(6,8-dimethylquinolin-4-yl)-1-(1-methylpiperidin-4-yl)piperazin-2-yl]ethanol is sourced from PubChem (CID 98771280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).