About 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine
4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine (PubChem CID 98772391) has the molecular formula C16H20N4
and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine.
Molecular Properties
| Compound Name | 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine |
| PubChem CID | 98772391 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine |
| SMILES | Cc1cc(N2C[C@@H](C)C[C@H]2C)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C16H20N4/c1-11-8-13(3)20(10-11)15-9-12(2)18-16(19-15)14-4-6-17-7-5-14/h4-7,9,11,13H,8,10H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | GZRCCFNWQMFIGU-WCQYABFASA-N |
| XLogP | 3.08 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine?
The IUPAC name of 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine (CID 98772391) is 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine.
What is the SMILES notation for 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine?
The canonical SMILES for 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine is Cc1cc(N2C[C@@H](C)C[C@H]2C)nc(-c2ccncc2)n1.
What is the InChIKey of 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine?
The InChIKey is GZRCCFNWQMFIGU-WCQYABFASA-N. The full InChI is InChI=1S/C16H20N4/c1-11-8-13(3)20(10-11)15-9-12(2)18-16(19-15)14-4-6-17-7-5-14/h4-7,9,11,13H,8,10H2,1-3H3/t11-,13+/m0/s1.
What are the key properties of 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine?
4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine has a molecular weight of 268.36 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,4S)-2,4-dimethylpyrrolidin-1-yl]-6-methyl-2-pyridin-4-ylpyrimidine is sourced from PubChem (CID 98772391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).