About 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea
1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea (PubChem CID 98773148) has the molecular formula C16H27N5O2
and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea.
Molecular Properties
| Compound Name | 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea |
| PubChem CID | 98773148 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea |
| SMILES | CO[C@@H]1CCCC[C@@H]1NC(=O)N[C@@H]1CCN(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C16H27N5O2/c1-20-11-13(9-17-20)21-8-7-12(10-21)18-16(22)19-14-5-3-4-6-15(14)23-2/h9,11-12,14-15H,3-8,10H2,1-2H3,(H2,18,19,22)/t12-,14+,15-/m1/s1 |
| InChIKey | YJKREVBHTXTQLF-VHDGCEQUSA-N |
| XLogP | 1.26 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea?
The IUPAC name of 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea (CID 98773148) is 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea.
What is the SMILES notation for 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea?
The canonical SMILES for 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea is CO[C@@H]1CCCC[C@@H]1NC(=O)N[C@@H]1CCN(c2cnn(C)c2)C1.
What is the InChIKey of 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea?
The InChIKey is YJKREVBHTXTQLF-VHDGCEQUSA-N. The full InChI is InChI=1S/C16H27N5O2/c1-20-11-13(9-17-20)21-8-7-12(10-21)18-16(22)19-14-5-3-4-6-15(14)23-2/h9,11-12,14-15H,3-8,10H2,1-2H3,(H2,18,19,22)/t12-,14+,15-/m1/s1.
What are the key properties of 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea?
1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea has a molecular weight of 321.43 g/mol, XLogP of 1.26, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-methoxycyclohexyl]-3-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]urea is sourced from PubChem (CID 98773148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).