C16H22N4O2 — CID 98777093
[(7R,8aS)-7-(cyclopropylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone (PubChem CID 98777093) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [(7R,8aS)-7-(cyclopropylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(7R,8aS)-7-(cyclopropylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 98777093 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [(7R,8aS)-7-(cyclopropylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCN2C[C@H](OCC3CC3)C[C@H]2C1 |
| InChI | InChI=1S/C16H22N4O2/c21-16(15-8-17-3-4-18-15)20-6-5-19-10-14(7-13(19)9-20)22-11-12-1-2-12/h3-4,8,12-14H,1-2,5-7,9-11H2/t13-,14+/m0/s1 |
| InChIKey | PTUDCEPGTGNUDN-UONOGXRCSA-N |
| XLogP | 0.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |