C16H26N4S — CID 98777364
2-[(2S,3aR,7aS)-5-methyl-2-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole (PubChem CID 98777364) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-[(2S,3aR,7aS)-5-methyl-2-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole.
| Compound Name | 2-[(2S,3aR,7aS)-5-methyl-2-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 98777364 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-[(2S,3aR,7aS)-5-methyl-2-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole |
| SMILES | CN1CC[C@H]2[C@H](C[C@@H](CN3CCCC3)N2c2nccs2)C1 |
| InChI | InChI=1S/C16H26N4S/c1-18-8-4-15-13(11-18)10-14(12-19-6-2-3-7-19)20(15)16-17-5-9-21-16/h5,9,13-15H,2-4,6-8,10-12H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | SMOMDICIHTXCCV-ILXRZTDVSA-N |
| XLogP | 2.14 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |