C15H25N5O — CID 98777365
(2S,3aR,7aS)-1-methyl-5-[(3S)-oxolan-3-yl]-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 98777365) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-methyl-5-[(3S)-oxolan-3-yl]-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (2S,3aR,7aS)-1-methyl-5-[(3S)-oxolan-3-yl]-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 98777365 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (2S,3aR,7aS)-1-methyl-5-[(3S)-oxolan-3-yl]-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1[C@H](Cn2cncn2)C[C@@H]2CN([C@H]3CCOC3)CC[C@@H]21 |
| InChI | InChI=1S/C15H25N5O/c1-18-14(8-20-11-16-10-17-20)6-12-7-19(4-2-15(12)18)13-3-5-21-9-13/h10-15H,2-9H2,1H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | FAPIYFIWZIVEGC-QPSCCSFWSA-N |
| XLogP | 0.46 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |