C17H29N5O — CID 98777367
(2S,3aR,7aS)-5-[(3S)-oxolan-3-yl]-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 98777367) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is (2S,3aR,7aS)-5-[(3S)-oxolan-3-yl]-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (2S,3aR,7aS)-5-[(3S)-oxolan-3-yl]-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 98777367 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | (2S,3aR,7aS)-5-[(3S)-oxolan-3-yl]-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CC(C)N1[C@H](Cn2cncn2)C[C@@H]2CN([C@H]3CCOC3)CC[C@@H]21 |
| InChI | InChI=1S/C17H29N5O/c1-13(2)22-16(9-21-12-18-11-19-21)7-14-8-20(5-3-17(14)22)15-4-6-23-10-15/h11-17H,3-10H2,1-2H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | GVLZGEQQVWRTNN-QZWWFDLISA-N |
| XLogP | 1.24 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |